ChemNet > CAS > 40046-30-8 3,5-Dimethylisothiocyanatobenzene
40046-30-8 3,5-Dimethylisothiocyanatobenzene
| Nazwa produktu: |
3,5-Dimethylisothiocyanatobenzene |
| Angielska nazwa |
3,5-Dimethylisothiocyanatobenzene; 3,5-Dimethylphenyl isothiocyanate; 1-isothiocyanato-3,5-dimethylbenzene |
| MF |
C9H9NS |
| Masie cząsteczkowej |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-7-3-8(2)5-9(4-7)10-6-11/h3-5H,1-2H3 |
| Nr CAS |
40046-30-8 |
| Struktury molekularnej |
|
| Gęstość |
1.01g/cm3 |
| Temperatura wrzenia |
282.2°C at 760 mmHg |
| Współczynnik załamania |
1.554 |
| Temperatura zapłonu |
127.3°C |
| Ciśnienie pary |
0.00582mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
