ChemNet > CAS > 40228-90-8 7-Phenylheptanoic acid
40228-90-8 7-Phenylheptanoic acid
| Nazwa produktu: |
7-Phenylheptanoic acid |
| Angielska nazwa |
7-Phenylheptanoic acid; |
| MF |
C13H18O2 |
| Masie cząsteczkowej |
206.2808 |
| InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
| Nr CAS |
40228-90-8 |
| Struktury molekularnej |
|
| Gęstość |
1.034g/cm3 |
| Temperatura wrzenia |
356.5°C at 760 mmHg |
| Współczynnik załamania |
1.519 |
| Temperatura zapłonu |
253.5°C |
| Ciśnienie pary |
1.06E-05mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
