4079-52-1 2-Methoxyacetophenone
Nazwa produktu: |
2-Methoxyacetophenone |
Angielska nazwa |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
MF |
C9H10O2 |
Masie cząsteczkowej |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
Nr CAS |
4079-52-1 |
EINECS |
223-802-4 |
Struktury molekularnej |
|
Gęstość |
1.035g/cm3 |
Temperatura topnienia |
7-8℃ |
Temperatura wrzenia |
245°C at 760 mmHg |
Współczynnik załamania |
1.504 |
Temperatura zapłonu |
92.8°C |
Ciśnienie pary |
0.0294mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|