4160-51-4 4'-methoxybutyrophenone
Nazwa produktu: |
4'-methoxybutyrophenone |
Angielska nazwa |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
MF |
C11H14O2 |
Masie cząsteczkowej |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
Nr CAS |
4160-51-4 |
EINECS |
223-995-5 |
Struktury molekularnej |
|
Gęstość |
1.001g/cm3 |
Temperatura wrzenia |
288.3°C at 760 mmHg |
Współczynnik załamania |
1.498 |
Temperatura zapłonu |
124.3°C |
Ciśnienie pary |
0.00236mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|