ChemNet > CAS > 41825-73-4 2-Bromo-4,6-dimethylaniline
41825-73-4 2-Bromo-4,6-dimethylaniline
| Nazwa produktu: |
2-Bromo-4,6-dimethylaniline |
| Angielska nazwa |
2-Bromo-4,6-dimethylaniline; Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| MF |
C8H10BrN |
| Masie cząsteczkowej |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| Nr CAS |
41825-73-4 |
| EINECS |
246-337-9 |
| Struktury molekularnej |
|
| Gęstość |
1.424g/cm3 |
| Temperatura topnienia |
49-79℃ |
| Temperatura wrzenia |
260.9°C at 760 mmHg |
| Współczynnik załamania |
1.596 |
| Temperatura zapłonu |
111.6°C |
| Ciśnienie pary |
0.0119mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
