ChemNet > CAS > 42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
Nazwa produktu: |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
Angielska nazwa |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile; (6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
MF |
C10H12N2S |
Masie cząsteczkowej |
192.2807 |
InChI |
InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
Nr CAS |
42225-04-7 |
Struktury molekularnej |
|
Gęstość |
1.22g/cm3 |
Temperatura topnienia |
147℃ |
Temperatura wrzenia |
392.8°C at 760 mmHg |
Współczynnik załamania |
1.607 |
Temperatura zapłonu |
191.4°C |
Ciśnienie pary |
2.23E-06mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|