ChemNet > CAS > 437-64-9 4',5-Dihydroxy-7-methoxyflavone
437-64-9 4',5-Dihydroxy-7-methoxyflavone
| Nazwa produktu: |
4',5-Dihydroxy-7-methoxyflavone |
| Angielska nazwa |
4',5-Dihydroxy-7-methoxyflavone; Genkwanin; Gengkwanin |
| MF |
C16H12O5 |
| Masie cząsteczkowej |
284.26 |
| InChI |
InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Nr CAS |
437-64-9 |
| Struktury molekularnej |
|
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
