ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
Nazwa produktu: |
4-Isopropylphenylacetonitrile |
Angielska nazwa |
4-Isopropylphenylacetonitrile; [4-(propan-2-yl)phenyl]acetonitrile; 4-Isopropylphenylaceotnitrile |
MF |
C11H13N |
Masie cząsteczkowej |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
Nr CAS |
4395-87-3 |
Struktury molekularnej |
|
Gęstość |
0.96g/cm3 |
Temperatura wrzenia |
261.1°C at 760 mmHg |
Współczynnik załamania |
1.514 |
Temperatura zapłonu |
117.5°C |
Ciśnienie pary |
0.0118mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|