ChemNet > CAS > 4441-01-4 1,2,4-Triphenyl-1,4-butanedione
4441-01-4 1,2,4-Triphenyl-1,4-butanedione
Nazwa produktu: |
1,2,4-Triphenyl-1,4-butanedione |
Angielska nazwa |
1,2,4-Triphenyl-1,4-butanedione;1,4-Butanedione, 1,2,4-triphenyl-; AI3-17642; NSC 7759; 1,2,4-triphenylbutane-1,4-dione; (2S)-1,2,4-triphenylbutane-1,4-dione; (2R)-1,2,4-triphenylbutane-1,4-dione |
MF |
C22H18O2 |
Masie cząsteczkowej |
314.3771 |
InChI |
InChI=1/C22H18O2/c23-21(18-12-6-2-7-13-18)16-20(17-10-4-1-5-11-17)22(24)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m1/s1 |
Nr CAS |
4441-01-4 |
Struktury molekularnej |
|
Gęstość |
1.143g/cm3 |
Temperatura wrzenia |
496.2°C at 760 mmHg |
Współczynnik załamania |
1.607 |
Temperatura zapłonu |
183.6°C |
Ciśnienie pary |
5.52E-10mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|