ChemNet > CAS > 4553-07-5 Ethyl phenylcyanoacetate
4553-07-5 Ethyl phenylcyanoacetate
| Nazwa produktu: |
Ethyl phenylcyanoacetate |
| Angielska nazwa |
Ethyl phenylcyanoacetate; Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
| MF |
C11H11NO2 |
| Masie cząsteczkowej |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
| Nr CAS |
4553-07-5 |
| EINECS |
224-921-4 |
| Struktury molekularnej |
|
| Gęstość |
1.117g/cm3 |
| Temperatura wrzenia |
275°C at 760 mmHg |
| Współczynnik załamania |
1.518 |
| Temperatura zapłonu |
137.5°C |
| Ciśnienie pary |
0.00523mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
