ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
| Nazwa produktu: |
(+/-)-3-phenylbutyric acid |
| Angielska nazwa |
(+/-)-3-phenylbutyric acid; 3-Phenylbutyric acid; 3-phenylbutanoic acid |
| MF |
C10H12O2 |
| Masie cząsteczkowej |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| Nr CAS |
4593-90-2 |
| EINECS |
224-987-4 |
| Struktury molekularnej |
|
| Gęstość |
1.09g/cm3 |
| Temperatura topnienia |
35-38℃ |
| Temperatura wrzenia |
288°C at 760 mmHg |
| Współczynnik załamania |
1.531 |
| Temperatura zapłonu |
170.2°C |
| Ciśnienie pary |
0.00112mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
