ChemNet > CAS > 4653-08-1 3-(2-thenoyl)propionic acid
4653-08-1 3-(2-thenoyl)propionic acid
Nazwa produktu: |
3-(2-thenoyl)propionic acid |
Angielska nazwa |
3-(2-thenoyl)propionic acid; 4-Oxo-4-(2-thienyl)butyric acid; 4-oxo-4-(thiophen-2-yl)butanoic acid; 4-oxo-4-thiophen-2-ylbutanoate |
MF |
C8H7O3S |
Masie cząsteczkowej |
183.2049 |
InChI |
InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
Nr CAS |
4653-08-1 |
EINECS |
225-089-5 |
Struktury molekularnej |
|
Temperatura wrzenia |
400.5°C at 760 mmHg |
Temperatura zapłonu |
196°C |
Ciśnienie pary |
3.93E-07mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|