ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
Nazwa produktu: |
4-(difluoromethoxy)benzoic acid |
Angielska nazwa |
4-(difluoromethoxy)benzoic acid;4-(difluoromethoxy)benzoate |
MF |
C8H5F2O3 |
Masie cząsteczkowej |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
Nr CAS |
4837-20-1 |
Struktury molekularnej |
|
Temperatura topnienia |
169-171℃ |
Temperatura wrzenia |
272.1°C at 760 mmHg |
Temperatura zapłonu |
118.3°C |
Ciśnienie pary |
0.00304mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|