486-84-0 Harmane
Nazwa produktu: |
Harmane |
Angielska nazwa |
Harmane; 1-Methyl-9H-pyrido[3,4-b]indole; Aribine~1-Methyl-9H-pyrido[3,4-b]indole; harman; 1-methyl-9H-beta-carboline
; 2-Methyl-?carboline; Aribine; 1-methyl-9H-beta-carboline |
MF |
C12H10N2 |
Masie cząsteczkowej |
182.2212 |
InChI |
InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
Nr CAS |
486-84-0 |
EINECS |
207-642-2 |
Struktury molekularnej |
|
Gęstość |
1.252g/cm3 |
Temperatura topnienia |
235-239℃ |
Temperatura wrzenia |
386.9°C at 760 mmHg |
Współczynnik załamania |
1.75 |
Temperatura zapłonu |
176.2°C |
Ciśnienie pary |
7.61E-06mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21:Harmful by inhalation and in contact with skin.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
|
|