488-87-9 2,5-dimetylorezorcynol
Nazwa produktu: |
2,5-dimetylorezorcynol |
Synonimy |
2,5-dimetylobenzeno-1,3-diol |
Angielska nazwa |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
MF |
C8H10O2 |
Masie cząsteczkowej |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
Nr CAS |
488-87-9 |
EINECS |
207-688-3 |
Struktury molekularnej |
|
Gęstość |
1.162g/cm3 |
Temperatura topnienia |
161℃ |
Temperatura wrzenia |
284.1°C at 760 mmHg |
Współczynnik załamania |
1.582 |
Temperatura zapłonu |
140.8°C |
Ciśnienie pary |
0.00178mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|