ChemNet > CAS > 491-78-1 Primuletin
491-78-1 Primuletin
| Nazwa produktu: |
Primuletin |
| Angielska nazwa |
Primuletin; 5-Hydroxyflavone; 5-Hydroxy-2-phenylchromone; 5-hydroxy-2-phenyl-4H-chromen-4-one |
| MF |
C15H10O3 |
| Masie cząsteczkowej |
238.2381 |
| InChI |
InChI=1/C15H10O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h1-9,16H |
| Nr CAS |
491-78-1 |
| EINECS |
207-743-1 |
| Struktury molekularnej |
|
| Gęstość |
1.34g/cm3 |
| Temperatura wrzenia |
425°C at 760 mmHg |
| Współczynnik załamania |
1.666 |
| Temperatura zapłonu |
165.4°C |
| Ciśnienie pary |
7.97E-08mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
