ChemNet > CAS > 4971-56-6 Tetrahydrofuran-2,4-dione
4971-56-6 Tetrahydrofuran-2,4-dione
Nazwa produktu: |
Tetrahydrofuran-2,4-dione |
Angielska nazwa |
Tetrahydrofuran-2,4-dione; Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
MF |
C4H4O3 |
Masie cząsteczkowej |
100.0728 |
InChI |
InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
Nr CAS |
4971-56-6 |
EINECS |
225-617-4 |
Struktury molekularnej |
|
Gęstość |
1.375g/cm3 |
Temperatura topnienia |
142-147℃ |
Temperatura wrzenia |
324.3°C at 760 mmHg |
Współczynnik załamania |
1.47 |
Temperatura zapłonu |
151.1°C |
Ciśnienie pary |
0.000248mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|