ChemNet > CAS > 499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
| Nazwa produktu: |
1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
| Angielska nazwa |
1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde; 1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde; 1-methylbenzotriazole-5-carbaldehyde |
| MF |
C8H7N3O |
| Masie cząsteczkowej |
161.1607 |
| InChI |
InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
| Nr CAS |
499770-67-1 |
| Struktury molekularnej |
|
| Gęstość |
1.333g/cm3 |
| Temperatura topnienia |
159℃ |
| Temperatura wrzenia |
354.124°C at 760 mmHg |
| Współczynnik załamania |
1.668 |
| Temperatura zapłonu |
167.968°C |
| Ciśnienie pary |
0mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
