ChemNet > CAS > 499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
| Nazwa produktu: |
1-benzyl-4-(3-nitropyridin-2-yl)piperazine |
| Angielska nazwa |
1-benzyl-4-(3-nitropyridin-2-yl)piperazine; |
| MF |
C16H18N4O2 |
| Masie cząsteczkowej |
298.3397 |
| InChI |
InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2 |
| Nr CAS |
499771-07-2 |
| Struktury molekularnej |
|
| Gęstość |
1.263g/cm3 |
| Temperatura topnienia |
64℃ |
| Temperatura wrzenia |
453°C at 760 mmHg |
| Współczynnik załamania |
1.628 |
| Temperatura zapłonu |
227.7°C |
| Ciśnienie pary |
2.15E-08mmHg at 25°C |
| Symbole zagrożenia |
C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|