ChemNet > CAS > 499771-09-4 3-amino-4-cyjano-5-piperynotiofeno-2-karboksylan metylu
499771-09-4 3-amino-4-cyjano-5-piperynotiofeno-2-karboksylan metylu
| Nazwa produktu: |
3-amino-4-cyjano-5-piperynotiofeno-2-karboksylan metylu |
| Synonimy |
3-amino-4-cyjano-5-piperydyno-1-ylotiofeno-2-karboksylan metylu |
| Angielska nazwa |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate;methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
| MF |
C12H15N3O2S |
| Masie cząsteczkowej |
265.3314 |
| InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
| Nr CAS |
499771-09-4 |
| Struktury molekularnej |
|
| Gęstość |
1.33g/cm3 |
| Temperatura topnienia |
183℃ |
| Temperatura wrzenia |
506.1°C at 760 mmHg |
| Współczynnik załamania |
1.613 |
| Temperatura zapłonu |
259.9°C |
| Ciśnienie pary |
2.29E-10mmHg at 25°C |
| Symbole zagrożenia |
Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|