501-24-6 3-n-Pentadecylphenol
Nazwa produktu: |
3-n-Pentadecylphenol |
Angielska nazwa |
3-n-Pentadecylphenol; Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
MF |
C21H36O |
Masie cząsteczkowej |
304.5099 |
InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
Nr CAS |
501-24-6 |
EINECS |
207-921-9 |
Struktury molekularnej |
|
Gęstość |
0.908g/cm3 |
Temperatura topnienia |
47-53℃ |
Temperatura wrzenia |
402°C at 760 mmHg |
Współczynnik załamania |
1.495 |
Temperatura zapłonu |
246.3°C |
Ciśnienie pary |
4.88E-07mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|