51-18-3 Triethylenemelamine
Nazwa produktu: |
Triethylenemelamine |
Angielska nazwa |
Triethylenemelamine; Tretamine; 2,4,6-tri(aziridin-1-yl)-1,3,5-triazine; 2,4,6-Tris(1-aziridinyl)-s-triazine; TEM; 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
MF |
C9H12N6 |
Masie cząsteczkowej |
204.2318 |
InChI |
InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
Nr CAS |
51-18-3 |
EINECS |
200-083-5 |
Struktury molekularnej |
|
Gęstość |
1.617g/cm3 |
Temperatura topnienia |
160℃ |
Temperatura wrzenia |
430.2°C at 760 mmHg |
Współczynnik załamania |
1.789 |
Temperatura zapłonu |
214°C |
Ciśnienie pary |
1.32E-07mmHg at 25°C |
Symbole zagrożenia |
T+:Very toxic;
|
Kody ryzyka |
R28:Very toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|