ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
| Nazwa produktu: |
6-phenoxynicotinic acid |
| Angielska nazwa |
6-phenoxynicotinic acid; 6-phenoxypyridine-3-carboxylic acid |
| MF |
C12H9NO3 |
| Masie cząsteczkowej |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| Nr CAS |
51362-38-0 |
| Struktury molekularnej |
|
| Gęstość |
1.298g/cm3 |
| Temperatura topnienia |
164℃ |
| Temperatura wrzenia |
391.2°C at 760 mmHg |
| Współczynnik załamania |
1.613 |
| Temperatura zapłonu |
190.4°C |
| Ciśnienie pary |
8.03E-07mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
