ChemNet > CAS > 51446-31-2 4-Fluoro-3-hydroxybenzoic acid
51446-31-2 4-Fluoro-3-hydroxybenzoic acid
Nazwa produktu: |
4-Fluoro-3-hydroxybenzoic acid |
Angielska nazwa |
4-Fluoro-3-hydroxybenzoic acid; (4-fluorophenyl)(3-phenyloxiran-2-yl)methanone; 4-fluoro-3-hydroxybenzoate; 3-Hydroxy-4-fluorobenzoic acid |
MF |
C7H4FO3 |
Masie cząsteczkowej |
155.1038 |
InChI |
InChI=1/C7H5FO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)/p-1 |
Nr CAS |
51446-31-2 |
Struktury molekularnej |
|
Temperatura wrzenia |
324°C at 760 mmHg |
Temperatura zapłonu |
149.7°C |
Ciśnienie pary |
0.000104mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|