ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
Nazwa produktu: |
4-Iodophenylacetonitrile |
Angielska nazwa |
4-Iodophenylacetonitrile; 4-Iodobenzyl cyanide |
MF |
C8H6IN |
Masie cząsteczkowej |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
Nr CAS |
51628-12-7 |
Struktury molekularnej |
|
Gęstość |
1.764g/cm3 |
Temperatura wrzenia |
285.8°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
126.6°C |
Ciśnienie pary |
0.00275mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|