ChemNet > CAS > 5220-49-5 3-Amino-2-cyclohexen-1-one
5220-49-5 3-Amino-2-cyclohexen-1-one
| Nazwa produktu: |
3-Amino-2-cyclohexen-1-one |
| Angielska nazwa |
3-Amino-2-cyclohexen-1-one; 3-aminocyclohex-2-enone; 3-aminocyclohex-2-en-1-one; methyl 1-methyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropyrido[2,3-d]pyrimidine-5-carboxylate; (3E)-3-iminocyclohexanone; 3-AMINO-2-CYCLOHEXENE-1-ONE |
| MF |
C6H9NO |
| Masie cząsteczkowej |
111.1418 |
| InChI |
InChI=1/C6H9NO/c7-5-2-1-3-6(8)4-5/h7H,1-4H2/b7-5+ |
| Nr CAS |
5220-49-5 |
| EINECS |
226-014-9 |
| Struktury molekularnej |
|
| Gęstość |
1.17g/cm3 |
| Temperatura wrzenia |
286.5°C at 760 mmHg |
| Współczynnik załamania |
1.558 |
| Temperatura zapłonu |
127.1°C |
| Ciśnienie pary |
0.00263mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
