ChemNet > CAS > 52287-51-1 3,4-Ethylenedioxybromobenzene
52287-51-1 3,4-Ethylenedioxybromobenzene
Nazwa produktu: |
3,4-Ethylenedioxybromobenzene |
Angielska nazwa |
3,4-Ethylenedioxybromobenzene; 3,4-(Ethylenedioxy)bromobenzene; 6-Bromo-1,4-benzodioxane; 6-Bromo-2,3-dihydro-1,4-benzodioxine |
MF |
C8H7BrO2 |
Masie cząsteczkowej |
215.044 |
InChI |
InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
Nr CAS |
52287-51-1 |
EINECS |
257-817-2 |
Struktury molekularnej |
|
Gęstość |
1.598g/cm3 |
Temperatura wrzenia |
258.299°C at 760 mmHg |
Współczynnik załamania |
1.579 |
Temperatura zapłonu |
117.638°C |
Ciśnienie pary |
0.022mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|