524-42-5 1,2-Naphthoquinone
Nazwa produktu: |
1,2-Naphthoquinone |
Angielska nazwa |
1,2-Naphthoquinone; 1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
MF |
C10H6O2 |
Masie cząsteczkowej |
158.1534 |
InChI |
InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
Nr CAS |
524-42-5 |
EINECS |
208-360-2 |
Struktury molekularnej |
|
Gęstość |
1.29g/cm3 |
Temperatura topnienia |
136-141℃ |
Temperatura wrzenia |
296.1°C at 760 mmHg |
Współczynnik załamania |
1.617 |
Temperatura zapłonu |
117.4°C |
Ciśnienie pary |
0.00147mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|