52414-97-8 3-Bromo-2-nitrotoluene
Nazwa produktu: |
3-Bromo-2-nitrotoluene |
Angielska nazwa |
3-Bromo-2-nitrotoluene; Benzene, 1-bromo-3-methyl-2-nitro-; 1-bromo-3-methyl-2-nitrobenzene; 3-Bromo-2-nitrobenzene |
MF |
C7H6BrNO2 |
Masie cząsteczkowej |
216.032 |
InChI |
InChI=1/C7H6BrNO2/c1-5-3-2-4-6(8)7(5)9(10)11/h2-4H,1H3 |
Nr CAS |
52414-97-8 |
Struktury molekularnej |
|
Gęstość |
1.615g/cm3 |
Temperatura topnienia |
26.8-29℃ |
Temperatura wrzenia |
237.4°C at 760 mmHg |
Współczynnik załamania |
1.592 |
Temperatura zapłonu |
97.4°C |
Ciśnienie pary |
0.0689mmHg at 25°C |
Symbole zagrożenia |
T:Toxic;
|
Kody ryzyka |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Bezpieczeństwo opis |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|