ChemNet > CAS > 52605-96-6 2-Chloro-3-methoxypyridine
52605-96-6 2-Chloro-3-methoxypyridine
| Nazwa produktu: |
2-Chloro-3-methoxypyridine |
| Angielska nazwa |
2-Chloro-3-methoxypyridine; |
| MF |
C6H6ClNO |
| Masie cząsteczkowej |
143.5709 |
| InChI |
InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| Nr CAS |
52605-96-6 |
| EINECS |
258-039-6 |
| Struktury molekularnej |
|
| Gęstość |
1.21g/cm3 |
| Temperatura wrzenia |
210.6°C at 760 mmHg |
| Współczynnik załamania |
1.517 |
| Temperatura zapłonu |
81.2°C |
| Ciśnienie pary |
0.276mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
