527-61-7 2,6-Dimethylbenzoquinone
Nazwa produktu: |
2,6-Dimethylbenzoquinone |
Angielska nazwa |
2,6-Dimethylbenzoquinone; |
MF |
C8H8O2 |
Masie cząsteczkowej |
136.15 |
InChI |
InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
Nr CAS |
527-61-7 |
EINECS |
208-420-8 |
Struktury molekularnej |
|
Temperatura topnienia |
69-74℃ |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|