ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
| Nazwa produktu: |
Methyl 2-amino-5-bromobenzoate |
| Angielska nazwa |
Methyl 2-amino-5-bromobenzoate; 2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
| MF |
C8H8BrNO2 |
| Masie cząsteczkowej |
230.0586 |
| InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
| Nr CAS |
52727-57-8 |
| Struktury molekularnej |
|
| Gęstość |
1.578g/cm3 |
| Temperatura topnienia |
72-74℃ |
| Temperatura wrzenia |
286.3°C at 760 mmHg |
| Współczynnik załamania |
1.601 |
| Temperatura zapłonu |
126.9°C |
| Ciśnienie pary |
0.00266mmHg at 25°C |
| Symbole zagrożenia |
 Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
