ChemNet > CAS > 5380-42-7 Thiophene-2-carboxylic acid methy lester
5380-42-7 Thiophene-2-carboxylic acid methy lester
| Nazwa produktu: |
Thiophene-2-carboxylic acid methy lester |
| Angielska nazwa |
Thiophene-2-carboxylic acid methy lester; Thiophene-2-carboxylic acid methyl ester; Methyl thiophene-2-carboxylate |
| MF |
C6H6O2S |
| Masie cząsteczkowej |
142.1756 |
| InChI |
InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| Nr CAS |
5380-42-7 |
| EINECS |
226-371-0 |
| Struktury molekularnej |
|
| Gęstość |
1.217g/cm3 |
| Temperatura wrzenia |
200.2°C at 760 mmHg |
| Współczynnik załamania |
1.535 |
| Temperatura zapłonu |
74.9°C |
| Ciśnienie pary |
0.329mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
