ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
| Nazwa produktu: |
thianaphthene-3-carboxaldehyde |
| Angielska nazwa |
thianaphthene-3-carboxaldehyde; 1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
| MF |
C9H6OS |
| Masie cząsteczkowej |
162.2083 |
| InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
| Nr CAS |
5381-20-4 |
| Struktury molekularnej |
|
| Gęstość |
1.3g/cm3 |
| Temperatura topnienia |
56-58℃ |
| Temperatura wrzenia |
303.2°C at 760 mmHg |
| Współczynnik załamania |
1.719 |
| Temperatura zapłonu |
137.2°C |
| Ciśnienie pary |
0.000944mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
