ChemNet > CAS > 5396-71-4 Ethyl 3-nitrocinnamate
5396-71-4 Ethyl 3-nitrocinnamate
| Nazwa produktu: |
Ethyl 3-nitrocinnamate |
| Angielska nazwa |
Ethyl 3-nitrocinnamate; 3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
| MF |
C11H11NO4 |
| Masie cząsteczkowej |
221.2093 |
| InChI |
InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
| Nr CAS |
5396-71-4 |
| EINECS |
226-415-9 |
| Struktury molekularnej |
|
| Gęstość |
1.237g/cm3 |
| Temperatura topnienia |
73-75℃ |
| Temperatura wrzenia |
346.7°C at 760 mmHg |
| Współczynnik załamania |
1.582 |
| Temperatura zapłonu |
154.5°C |
| Ciśnienie pary |
5.65E-05mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
