5414-99-3 Glutaranilic Acid
Nazwa produktu: |
Glutaranilic Acid |
Angielska nazwa |
Glutaranilic Acid; N-Phenylglutaramic Acid; Pentanedioic acid mono(N-phenyl)amide; 5-oxo-5-(phenylamino)pentanoic acid; 5-oxo-5-(phenylamino)pentanoate |
MF |
C11H12NO3 |
Masie cząsteczkowej |
206.2184 |
InChI |
InChI=1/C11H13NO3/c13-10(7-4-8-11(14)15)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)(H,14,15)/p-1 |
Nr CAS |
5414-99-3 |
Struktury molekularnej |
|
Temperatura wrzenia |
478.5°C at 760 mmHg |
Temperatura zapłonu |
243.2°C |
Ciśnienie pary |
5.78E-10mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|