ChemNet > CAS > 543-20-4 Succinyl chloride
543-20-4 Succinyl chloride
Nazwa produktu: |
Succinyl chloride |
Angielska nazwa |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
MF |
C4H4Cl2O2 |
Masie cząsteczkowej |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
Nr CAS |
543-20-4 |
EINECS |
208-838-0 |
Struktury molekularnej |
|
Gęstość |
1.389g/cm3 |
Temperatura topnienia |
16-17℃ |
Temperatura wrzenia |
193.4°C at 760 mmHg |
Współczynnik załamania |
1.456 |
Temperatura zapłonu |
76.7°C |
Ciśnienie pary |
0.466mmHg at 25°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|