ChemNet > CAS > 54745-92-5 chlorek 2-chinoksaloilu
54745-92-5 chlorek 2-chinoksaloilu
Nazwa produktu: |
chlorek 2-chinoksaloilu |
Synonimy |
chlorek 2-chinoksalinokarbonylu; chlorek chinoksalino-2-karbonylu |
Angielska nazwa |
2-quinoxaloyl chloride; 2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
MF |
C9H5ClN2O |
Masie cząsteczkowej |
192.6018 |
InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
Nr CAS |
54745-92-5 |
EINECS |
259-315-9 |
Struktury molekularnej |
|
Gęstość |
1.411g/cm3 |
Temperatura topnienia |
113℃ |
Temperatura wrzenia |
324.4°C at 760 mmHg |
Współczynnik załamania |
1.662 |
Temperatura zapłonu |
150°C |
Ciśnienie pary |
0.000246mmHg at 25°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|