ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
| Nazwa produktu: |
1,4-Cyclohexanediol, mixture of cis and trans |
| Angielska nazwa |
1,4-Cyclohexanediol, mixture of cis and trans; Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
| MF |
C6H12O2 |
| Masie cząsteczkowej |
116.1583 |
| InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
| Nr CAS |
556-48-9 |
| EINECS |
209-126-2 |
| Struktury molekularnej |
|
| Gęstość |
1.156g/cm3 |
| Temperatura topnienia |
98-100℃ |
| Temperatura wrzenia |
252.4°C at 760 mmHg |
| Współczynnik załamania |
1.526 |
| Temperatura zapłonu |
65.6°C |
| Ciśnienie pary |
0.00301mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:;
|
|
