571-61-9 1,5-Dimethylnaphthalene
Nazwa produktu: |
1,5-Dimethylnaphthalene |
Angielska nazwa |
1,5-Dimethylnaphthalene;NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
MF |
C12H12 |
Masie cząsteczkowej |
156.2237 |
InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
Nr CAS |
571-61-9 |
EINECS |
209-338-5 |
Struktury molekularnej |
|
Gęstość |
1g/cm3 |
Temperatura topnienia |
78-266℃ |
Temperatura wrzenia |
265.6°C at 760 mmHg |
Współczynnik załamania |
1.604 |
Temperatura zapłonu |
111.4°C |
Ciśnienie pary |
0.0149mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|