ChemNet > CAS > 571-61-9 1,5-Dimethylnaphthalene
571-61-9 1,5-Dimethylnaphthalene
| Nazwa produktu: |
1,5-Dimethylnaphthalene |
| Angielska nazwa |
1,5-Dimethylnaphthalene;NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
| MF |
C12H12 |
| Masie cząsteczkowej |
156.2237 |
| InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| Nr CAS |
571-61-9 |
| EINECS |
209-338-5 |
| Struktury molekularnej |
|
| Gęstość |
1g/cm3 |
| Temperatura topnienia |
78-266℃ |
| Temperatura wrzenia |
265.6°C at 760 mmHg |
| Współczynnik załamania |
1.604 |
| Temperatura zapłonu |
111.4°C |
| Ciśnienie pary |
0.0149mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
