589-62-8 4-octanol
Nazwa produktu: |
4-octanol |
Angielska nazwa |
4-octanol; n-Butyl n-propyl carbinol; octan-4-ol |
MF |
C8H18O |
Masie cząsteczkowej |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
Nr CAS |
589-62-8 |
EINECS |
209-654-3 |
Struktury molekularnej |
|
Gęstość |
0.821g/cm3 |
Temperatura wrzenia |
179.2°C at 760 mmHg |
Współczynnik załamania |
1.426 |
Temperatura zapłonu |
71.1°C |
Ciśnienie pary |
0.284mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|