ChemNet > CAS > 59463-56-8 etanetyan cyjanometylu
59463-56-8 etanetyan cyjanometylu
Nazwa produktu: |
etanetyan cyjanometylu |
Synonimy |
iół S-(cyjanometylu) |
Angielska nazwa |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
MF |
C4H5NOS |
Masie cząsteczkowej |
115.1536 |
InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
Nr CAS |
59463-56-8 |
Struktury molekularnej |
|
Gęstość |
1.162g/cm3 |
Temperatura wrzenia |
198.1°C at 760 mmHg |
Współczynnik załamania |
1.487 |
Temperatura zapłonu |
73.6°C |
Ciśnienie pary |
0.367mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|