611-79-0 3,3'-Diaminobenzophenone
Nazwa produktu: |
3,3'-Diaminobenzophenone |
Angielska nazwa |
3,3'-Diaminobenzophenone; bis(3-aminophenyl)methanone |
MF |
C13H12N2O |
Masie cząsteczkowej |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
Nr CAS |
611-79-0 |
EINECS |
210-281-3 |
Struktury molekularnej |
|
Gęstość |
1.233g/cm3 |
Temperatura wrzenia |
469.4°C at 760 mmHg |
Współczynnik załamania |
1.673 |
Temperatura zapłonu |
237.7°C |
Ciśnienie pary |
5.51E-09mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|