ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
| Nazwa produktu: |
3-Methylthiophene-2-carbonyl chloride |
| Angielska nazwa |
3-Methylthiophene-2-carbonyl chloride; 2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
| MF |
C6H5ClOS |
| Masie cząsteczkowej |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| Nr CAS |
61341-26-2 |
| Struktury molekularnej |
|
| Gęstość |
1.32g/cm3 |
| Temperatura wrzenia |
219.9°C at 760 mmHg |
| Współczynnik załamania |
1.566 |
| Temperatura zapłonu |
86.8°C |
| Ciśnienie pary |
0.116mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
