ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
Nazwa produktu: |
2,5-Dihydroxy-1,4-benzoquinone |
Angielska nazwa |
2,5-Dihydroxy-1,4-benzoquinone; 2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
MF |
C6H4O4 |
Masie cząsteczkowej |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
Nr CAS |
615-94-1 |
EINECS |
210-454-3 |
Struktury molekularnej |
|
Gęstość |
1.843g/cm3 |
Temperatura topnienia |
220℃ |
Temperatura wrzenia |
322.3°C at 760 mmHg |
Współczynnik załamania |
1.729 |
Temperatura zapłonu |
162.9°C |
Ciśnienie pary |
2.24E-05mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|