622-52-6 P-Tolylthiourea
Nazwa produktu: |
P-Tolylthiourea |
Angielska nazwa |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
MF |
C8H10N2S |
Masie cząsteczkowej |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
Nr CAS |
622-52-6 |
EINECS |
210-740-8 |
Struktury molekularnej |
|
Gęstość |
1.242g/cm3 |
Temperatura wrzenia |
282.5°C at 760 mmHg |
Współczynnik załamania |
1.696 |
Temperatura zapłonu |
124.6°C |
Ciśnienie pary |
0.00335mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R25:Toxic if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|