ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
Nazwa produktu: |
4-Methoxybenzyl mercaptan |
Angielska nazwa |
4-Methoxybenzyl mercaptan; 4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol |
MF |
C8H10OS |
Masie cząsteczkowej |
154.2294 |
InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
Nr CAS |
6258-60-2 |
EINECS |
228-393-6 |
Struktury molekularnej |
|
Gęstość |
1.072g/cm3 |
Temperatura wrzenia |
294.5°C at 760 mmHg |
Współczynnik załamania |
1.549 |
Temperatura zapłonu |
103.4°C |
Ciśnienie pary |
0.00284mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|