626-27-7 Heptanoic anhydride
Nazwa produktu: |
Heptanoic anhydride |
Angielska nazwa |
Heptanoic anhydride; Enanthicanhydride; Oenanthic anhydride; Enanthic anhydride |
MF |
C14H26O3 |
Masie cząsteczkowej |
242.3544 |
InChI |
InChI=1/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
Nr CAS |
626-27-7 |
EINECS |
210-940-5 |
Struktury molekularnej |
|
Gęstość |
0.931g/cm3 |
Temperatura topnienia |
-12℃ |
Temperatura wrzenia |
269.5°C at 760 mmHg |
Współczynnik załamania |
1.44 |
Temperatura zapłonu |
129.9°C |
Ciśnienie pary |
0.00723mmHg at 25°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|