632-22-4 1,1,3,3-Tetramethylurea
Nazwa produktu: |
1,1,3,3-Tetramethylurea |
Angielska nazwa |
1,1,3,3-Tetramethylurea; Tetramethylurea |
MF |
C5H12N2O |
Masie cząsteczkowej |
116.16 |
InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
Nr CAS |
632-22-4 |
EINECS |
211-173-9 |
Struktury molekularnej |
|
Gęstość |
0.9879 |
Temperatura topnienia |
-1℃ |
Temperatura wrzenia |
174-178℃ |
Współczynnik załamania |
1.4496-1.4516 |
Temperatura zapłonu |
65℃ |
Rozpuszczalność w wodzie |
miscible |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:;
|
Bezpieczeństwo opis |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|