ChemNet > CAS > 6326-14-3 2,4-Dichlorophenylthiourae
6326-14-3 2,4-Dichlorophenylthiourae
Nazwa produktu: |
2,4-Dichlorophenylthiourae |
Angielska nazwa |
2,4-Dichlorophenylthiourae; |
MF |
C7H6Cl2N2S |
Masie cząsteczkowej |
221.1069 |
InChI |
InChI=1/C7H6Cl2N2S/c8-4-1-2-6(5(9)3-4)11-7(10)12/h1-3H,(H3,10,11,12) |
Nr CAS |
6326-14-3 |
Struktury molekularnej |
|
Gęstość |
1.563g/cm3 |
Temperatura wrzenia |
321.8°C at 760 mmHg |
Współczynnik załamania |
1.73 |
Temperatura zapłonu |
148.4°C |
Ciśnienie pary |
0.000292mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|